Systematic / IUPAC Name: Dibutyl decanedioate
ID: Reference2658
Other Names:
Kodaflex DBS ;
Monoplex DBS ;
Plasthall DBS ;
Polycizer DBS ;
Reomol DBS
; more
Formula: C18H34O4
Class: Extractables/Leachables Industrial Chemicals Excipients/Additives/Colorants Personal Care Products/Cosmetics
Dibutyl sebacate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 355 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/16/2016 12:47:27 PM |
| InChI | InChI=1S/C18H34O4/c1-3-5-15-21-17(19)13-11-9-7-8-10-12-14-18(20)22-16-6-4-2/h3-16H2,1-2H3 |
| InChI Key | PYGXAGIECVVIOZ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)CCCCCCCCC(=O)OCCCC |
| CAS | 109433 |
| Splash | |
| Other Names |
Kodaflex DBS ; Monoplex DBS ; Plasthall DBS ; Polycizer DBS ; Reomol DBS ; Staflex DBS ; Uniflex DBS ; 1,10-Dibutyl decanedioate; Bis(n-butyl) sebacate; Butyl sebacate; Decanedioic acid dibutyl ester; Decanedioic acid, 1,10-dibutyl ester; Dibutyl 1,8-octanedicarboxylate; Dibutyl sebacinate; Di-n-butyl sebacate ; n-Butyl sebacate; Sebacic acid dibutyl ester |
| ChEMBL | CHEMBL2106225 |
| KEGG | D03782 |
| HMDb | HMDB41220 |
| ChemSpider | 13837584 |
| Wikipedia | Dibutyl sebacate |
| PubChem | 7986 |