Systematic / IUPAC Name: 2-Ethylhexyl diphenyl phosphate
ID: Reference2668
Other Names:
Octicizer;
Phosflex 362;
Santicizer 141;
(2-Ethylhexyl)-difenylfosfat;
2-Ethylhexyl diphenylphosphate
; more
Formula: C20H27O4P
Class: Extractables/Leachables Industrial Chemicals Textile Chemicals/Auxiliary/Dyes
2-Ethylhexyldiphenyl phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2016 1:13:50 PM |
| InChI | InChI=1S/C20H27O4P/c1-3-5-12-18(4-2)17-22-25(21,23-19-13-8-6-9-14-19)24-20-15-10-7-11-16-20/h6-11,13-16,18H,3-5,12,17H2,1-2H3 |
| InChI Key | CGSLYBDCEGBZCG-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)COP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2 |
| CAS | 1241947 |
| Splash | |
| Other Names |
Octicizer; Phosflex 362; Santicizer 141; (2-Ethylhexyl)-difenylfosfat; 2-Ethylhexyl diphenylphosphate; Diphenyl 2-ethylhexyl phosphate; Ethylhexyl diphenyl phosphate, 2-; Phosphoric acid 2-ethylhexyl diphenyl ester; Phosphoric acid diphenyl 2-ethylhexyl ester |
| ChemSpider | 14040 |
| ChemIDPlus | 001241947 |
| PubChem | 14716 |
| KEGG | D05224 |
| ChEMBL | CHEMBL2105213 |