Systematic / IUPAC Name: 4-(1-Phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline
ID: Reference2672
Other Names: Benzenamine, 4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]-
Formula: C28H27N
Class: Extractables/Leachables Industrial Chemicals
4-(1-Phenylethyl)-N-[4-(1-phenylethyl)phenyl]aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 3/16/2016 1:35:40 PM |
| InChI | InChI=1S/C28H27N/c1-21(23-9-5-3-6-10-23)25-13-17-27(18-14-25)29-28-19-15-26(16-20-28)22(2)24-11-7-4-8-12-24/h3-22,29H,1-2H3 |
| InChI Key | BRWSDEFCJGIRLV-UHFFFAOYSA-N |
| Canonical SMILES | CC(C1=CC=CC=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C(C)C4=CC=CC=C4 |
| CAS | 68442682 |
| Splash | |
| Other Names | Benzenamine, 4-(1-phenylethyl)-N-[4-(1-phenylethyl)phenyl]- |