Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-Pentacosafluorotridecanoic acid
ID: Reference2693
Other Names:
Pentacosafluorotridecanoic acid;
Perfluorotridecanoic acid
Formula: C13HF25O2
Class: Extractables/Leachables Perfluorinated Hydrocarbons Textile Chemicals/Auxiliary/Dyes
Perfluorotridecanoic acid (PFTrDA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 576 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/27/2018 8:43:49 AM |
| InChI | InChI=1S/C13HF25O2/c14-2(15,1(39)40)3(16,17)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)11(32,33)12(34,35)13(36,37)38/h(H,39,40) |
| InChI Key | LVDGGZAZAYHXEY-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 72629948 |
| Splash | |
| Other Names |
Pentacosafluorotridecanoic acid; Perfluorotridecanoic acid |
| ChEMBL | CHEMBL2447939 |
| ChemSpider | 2285907 |
| ChemIDPlus | 072629948 |
| PubChem | 3018355 |