Systematic / IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Henicosafluoroundecanoic acid
ID: Reference2695
Other Names:
Heneicosafluoroundecanoic acid;
Henicosafluoroundecanoic acid;
Perfluoro-n-undecanoic acid;
Perfluoroundecanoic acid;
Undecanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro-
Formula: C11HF21O2
Class: Extractables/Leachables Perfluorinated Hydrocarbons Textile Chemicals/Auxiliary/Dyes
Perfluoroundecanoic acid (PFUdA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 714 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 11/27/2018 8:44:24 AM |
| InChI | InChI=1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) |
| InChI Key | SIDINRCMMRKXGQ-UHFFFAOYSA-N |
| Canonical SMILES | C(=O)(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| CAS | 2058948 |
| Splash | |
| Other Names |
Heneicosafluoroundecanoic acid; Henicosafluoroundecanoic acid; Perfluoro-n-undecanoic acid; Perfluoroundecanoic acid; Undecanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro- |