Systematic / IUPAC Name: N-Butylbenzenesulfonamide
ID: Reference2705
Other Names:
Uniplex 214;
Benzenesulfonamide, N-butyl-;
Benzenesulfonic acid butyl amide;
Butyl(phenylsulfonyl)amine;
N-(n-Butyl)benzenesulfonamide
; more
Formula: C10H15NO2S
Class: Extractables/Leachables Endogenous Metabolites Natural Toxins Industrial Chemicals Natural Products/Medicines
N-Butylbenzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 12:56:56 PM |
| InChI | InChI=1S/C10H15NO2S/c1-2-3-9-11-14(12,13)10-7-5-4-6-8-10/h4-8,11H,2-3,9H2,1H3 |
| InChI Key | IPRJXAGUEGOFGG-UHFFFAOYSA-N |
| Canonical SMILES | CCCCNS(=O)(=O)C1=CC=CC=C1 |
| CAS | 3622842 |
| Splash | |
| Other Names |
Uniplex 214; Benzenesulfonamide, N-butyl-; Benzenesulfonic acid butyl amide; Butyl(phenylsulfonyl)amine; N-(n-Butyl)benzenesulfonamide; N-Butyl benzene sulfonamide; N-Butylbenzenesulphonamide; N-n-Butyl benzenesulfonamide; Cetamoll BMB; Dellatol BBS; NBB; Plasthall BSA; Plastomoll BMB |
| PubChem | 19241 |
| DrugBank | DB02055 |
| ChemSpider | 18156 |
| ChEBI | CHEBI:44237 |
| ChemIDPlus | 003622842 |