Systematic / IUPAC Name: Dipropan-2-yl benzene-1,2-dicarboxylate
ID: Reference2719
Other Names:
1,2-Benzenedicarboxylic acid, bis(1-methylethyl) ester;
Diisopropyl phthalate;
Methylethyl 2-[(methylethyl)oxycarbonyl]benzoate;
Phthalic acid diisopropyl ester
Formula: C14H18O4
Class: Extractables/Leachables
Diisopropyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 1:48:43 PM |
| InChI | InChI=1S/C14H18O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-10H,1-4H3 |
| InChI Key | QWDBCIAVABMJPP-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)C |
| CAS | 605458 |
| Splash | |
| Other Names |
1,2-Benzenedicarboxylic acid, bis(1-methylethyl) ester; Diisopropyl phthalate; Methylethyl 2-[(methylethyl)oxycarbonyl]benzoate; Phthalic acid diisopropyl ester |
| ChemSpider | 11306 |
| ChemIDPlus | 000605458 |
| ChEMBL | CHEMBL2130656 |
| PubChem | 11799 |
| KEGG | C14468 |