Systematic / IUPAC Name: Tris(2-methylphenyl) phosphate
ID: Reference2724
Other Names:
o-Cresyl phosphate;
o-Tolyl phosphate;
o-Trikresylphosphate;
o-Trioyl phosphate;
Phosflex 179C
; more
Formula: C21H21O4P
Class: Extractables/Leachables Textile Chemicals/Auxiliary/Dyes
Tri-o-Cresyl phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 11:40:14 AM |
| InChI | InChI=1S/C21H21O4P/c1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
| InChI Key | YSMRWXYRXBRSND-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=CC=C1OP(=O)(OC2=CC=CC=C2C)OC3=CC=CC=C3C |
| CAS | 78308 |
| Splash | |
| Other Names |
o-Cresyl phosphate; o-Tolyl phosphate; o-Trikresylphosphate; o-Trioyl phosphate; Phosflex 179C; Phosphoric acid tri-o-cresyl ester; Phosphoric acid tri-o-tolyl ester; Phosphoric acid, tri-o-cresyl ester; Phosphoric acid, tri-o-tolyl ester; tri-o-Tolyl ester phosphoric acid; tri-o-Tolyl phosphate; tri-2-Tolyl phosphate; Triorthocresyl phosphate; Tris(o-cresyl)-phosphate; Tris-o-tolyl phosphate; Trojkrezylu fosforan; Phosphoric acid, tri-2-methylphenyl ester; Phosphoric acid, tris(2-methylphenyl) ester; tri-2-Methylphenyl phosphate; Tris(o-methylphenyl)phosphate; TOCP; TOFK; TOTP |
| ChemSpider | 21106216 |
| PubChem | 6527 |
| ChEMBL | CHEMBL3181798 |
| Wikipedia | Tricresyl phosphate |