Systematic / IUPAC Name: (E)-But-2-enoic acid
ID: Reference2732
Other Names:
α-Butenoate;
α-Butenoic acid;
α-Crotonic acid;
(E)-2-Butenoic acid;
(E)-Crotonic acid
; more
Formula: C4H6O2
Class: Extractables/Leachables Excipients/Additives/Colorants Industrial Chemicals Endogenous Metabolites
Crotonic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 194 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/2/2015 2:10:05 PM |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/b3-2+ |
| InChI Key | LDHQCZJRKDOVOX-NSCUHMNNSA-N |
| Canonical SMILES | CC=CC(=O)O |
| CAS | 107937 |
| Splash | |
| Other Names |
α-Butenoate; α-Butenoic acid; α-Crotonic acid; (E)-2-Butenoic acid; (E)-Crotonic acid; (2E)-2-Butenoic acid; (2E)-But-2-enoic acid; trans-2-Butenoate; trans-2-Butenoic acid; trans-Crotonic acid; 2E-Butenoic acid; 2-Butenoate; 2-Butenoic acid; 2-Butenoic acid, (E)-; 2-Butenoic acid, (2E)-; But-2-enoic acid; Crotonic acid, (E)-; β-Methacrylic acid; β-Methylacrylic acid; 3-Methylacrylic acid; Acrylic acid, 3-methyl- |
| ChemSpider | 552744 |
| HMDb | HMDB10720 |
| KEGG | C01771 |
| DrugBank | DB02074 |
| LipidsMAPs | LMFA01030195 |
| ChEBI | CHEBI:41131 |
| ChemIDPlus | 003724650; 000107937; 067785619; UM0610000 |
| PubChem | 637090 |
| Wikipedia | Crotonic_acid |