Systematic / IUPAC Name: N-Ethyl-N-[(heptadecafluorooctyl)sulfonyl]glycine
ID: Reference2750
Other Names:
N-Ethyl-N-[(heptadecafluorooctyl)sulphonyl]glycine ;
2-(N-Ethyl-perfluorooctane sulfonamido) acetic acid;
Glycine, N-ethyl-N-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl]-;
Glycine, N-ethyl-N-[(heptadecafluorooctyl)sulfonyl]-
Formula: C12H8F17NO4S
Class: Extractables/Leachables Perfluorinated Hydrocarbons
N-Ethylperfluoro-1-octanesulfonamidoacetic acid (N-EtPFOSAA) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 2096 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 3/29/2018 7:55:09 AM |
| InChI | InChI=1S/C12H8F17NO4S/c1-2-30(3-4(31)32)35(33,34)12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h2-3H2,1H3,(H,31,32) |
| InChI Key | CKRXVVGETMYFIO-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC(=O)O)S(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| CAS | 2991506 |
| Splash | |
| Other Names |
N-Ethyl-N-[(heptadecafluorooctyl)sulphonyl]glycine ; 2-(N-Ethyl-perfluorooctane sulfonamido) acetic acid; Glycine, N-ethyl-N-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)sulfonyl]-; Glycine, N-ethyl-N-[(heptadecafluorooctyl)sulfonyl]- |
| ChEBI | CHEBI:83507 |
| ChemSpider | 17128 |
| PubChem | 18134 |
| ChemIDPlus | 002991517; 002991506 |