Systematic / IUPAC Name: 1-Benzylquinolin-1-ium
ID: Reference2755
Other Names: Quinolinium, 1-(phenylmethyl)-
Formula: C16H14N+
1-Benzylquinolinium mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/1/2015 12:05:16 PM |
| InChI | InChI=1S/C16H14N/c1-2-7-14(8-3-1)13-17-12-6-10-15-9-4-5-11-16(15)17/h1-12H,13H2/q+1 |
| InChI Key | VQGBPCIONNQYIL-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C[N+]2=CC=CC3=CC=CC=C32 |
| CAS | |
| Splash | |
| Other Names | Quinolinium, 1-(phenylmethyl)- |
| PubChem | 85026 |
| ChemSpider | 76695 |
| ChEMBL | CHEMBL3306209 |