Systematic / IUPAC Name: N'-[3-(dimethylamino)propyl]-N,N,N'-trimethylpropane-1,3-diamine
ID: Reference2769
Other Names:
N,N,N'-Trimethyl-N'-[3-(dimethylamino)propyl]-1,3-propanediamine ;
1,3-Propanediamine, N1-[3-(dimethylamino)propyl]-N1,N3,N3-trimethyl- ;
2,6,10-Trimethyl-2,6,10-triazaundecane
Formula: C11H27N3
Class: Extractables/Leachables Industrial Chemicals
2,6,10-Trimethyl-2,6,10-triazaundecane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:00:54 AM |
| InChI | InChI=1S/C11H27N3/c1-12(2)8-6-10-14(5)11-7-9-13(3)4/h6-11H2,1-5H3 |
| InChI Key | SKCNNQDRNPQEFU-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CCCN(C)CCCN(C)C |
| CAS | 3855321 |
| Splash | |
| Other Names |
N,N,N'-Trimethyl-N'-[3-(dimethylamino)propyl]-1,3-propanediamine ; 1,3-Propanediamine, N1-[3-(dimethylamino)propyl]-N1,N3,N3-trimethyl- ; 2,6,10-Trimethyl-2,6,10-triazaundecane |
| ChemIDPlus | 003855321 |
| ChEMBL | CHEMBL3183623 |
| PubChem | 77463 |
| ChemSpider | 69872 |