Systematic / IUPAC Name: 2-{2-[2-(2-Ethylhexanoyloxy)ethoxy]ethoxy}ethyl 2-ethylhexanoate
ID: Reference2770
Other Names:
Flexol 3GO;
Flexol plasticizer 3GO;
Ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylhexanoate);
Hexanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester;
tri-(Ethylene glycol) bis(2-ethylhexanoate)
; more
Formula: C22H42O6
Class: Extractables/Leachables Industrial Chemicals Textile Chemicals/Auxiliary/Dyes
Triethyleneglycol bis(2-ethylhexanoate) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 235 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/8/2016 1:15:16 PM |
| InChI | InChI=1S/C22H42O6/c1-5-9-11-19(7-3)21(23)27-17-15-25-13-14-26-16-18-28-22(24)20(8-4)12-10-6-2/h19-20H,5-18H2,1-4H3 |
| InChI Key | FRQDZJMEHSJOPU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)C(=O)OCCOCCOCCOC(=O)C(CC)CCCC |
| CAS | 94280 |
| Splash | |
| Other Names |
Flexol 3GO; Flexol plasticizer 3GO; Ethane-1,2-diylbis(oxyethane-2,1-diyl) bis(2-ethylhexanoate); Hexanoic acid, 2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester; tri-(Ethylene glycol) bis(2-ethylhexanoate); Triethylene glycol, bis(2-ethylhexanoate); Triethylene glycol, bis(ethylhexanoate); TEG(EH); Kodaflex TEG-EH |
| ChEMBL | CHEMBL3185676 |
| PubChem | 7185 |
| ChemSpider | 6917 |
| ChemIDPlus | 000094280 |