Systematic / IUPAC Name: 2-chloro-N-[phenyl(piperidin-2-yl)methyl]-3-(trifluoromethyl)benzamide
ID: Reference2782
Other Names: Benzamide, 2-chloro-N-(phenyl-2-piperidinylmethyl)-3-(trifluoromethyl)-
Formula: C20H20ClF3N2O
SSR504734 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 186 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:38:35 PM |
| InChI | InChI=1S/C20H20ClF3N2O/c21-17-14(9-6-10-15(17)20(22,23)24)19(27)26-18(13-7-2-1-3-8-13)16-11-4-5-12-25-16/h1-3,6-10,16,18,25H,4-5,11-12H2,(H,26,27) |
| InChI Key | MEZRZVWPLXVLSO-UHFFFAOYSA-N |
| Canonical SMILES | C1CCNC(C1)C(C2=CC=CC=C2)NC(=O)C3=C(C(=CC=C3)C(F)(F)F)Cl |
| CAS | 742693385 |
| Splash | |
| Other Names | Benzamide, 2-chloro-N-(phenyl-2-piperidinylmethyl)-3-(trifluoromethyl)- |
| ChEMBL | CHEMBL2136521 |
| PubChem | 11998345 |
| ChemSpider | 10170812 |