Systematic / IUPAC Name: N-[(1-{[2-(Diethylamino)ethyl]amino}-7-methoxy-9-oxo-9H-thioxanthen-4-yl)methyl]formamide
ID: Reference2788
Other Names:
N-[1-(2-Diethylamino-ethylamino)-7-methoxy-9-oxo-9H-thioxanthen-4-ylmethyl]-formamide;
Formamide, N-[(1-{[2-(diethylamino)ethyl]amino}-7-methoxy-9-oxo-9H-thioxanthen-4-yl)methyl]-
Formula: C22H27N3O3S
SR271425 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:43:17 PM |
| InChI | InChI=1S/C22H27N3O3S/c1-4-25(5-2)11-10-24-18-8-6-15(13-23-14-26)22-20(18)21(27)17-12-16(28-3)7-9-19(17)29-22/h6-9,12,14,24H,4-5,10-11,13H2,1-3H3,(H,23,26) |
| InChI Key | GWLFIMOOGVXSMZ-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCNC1=C2C(=C(C=C1)CNC=O)SC3=C(C2=O)C=C(C=C3)OC |
| CAS | 155990208 |
| Splash | |
| Other Names |
N-[1-(2-Diethylamino-ethylamino)-7-methoxy-9-oxo-9H-thioxanthen-4-ylmethyl]-formamide; Formamide, N-[(1-{[2-(diethylamino)ethyl]amino}-7-methoxy-9-oxo-9H-thioxanthen-4-yl)methyl]- |
| ChemSpider | 8085329 |
| ChEMBL | CHEMBL434812 |
| PubChem | 9909677 |