Systematic / IUPAC Name: 5-Fluoro-1-(3-fluorobenzyl)-N-(1H-indol-5-yl)-1H-indole-2-carboxamide
ID: Reference2791
Other Names: N-(1H-Indol-5-yl)-5-fluoro-1-(3-fluoro-benzyl)-1H-indole-2-carboxamide
Formula: C24H17F2N3O
SAR115740 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 235 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 1:03:15 PM |
| InChI | InChI=1S/C24H17F2N3O/c25-18-3-1-2-15(10-18)14-29-22-7-4-19(26)11-17(22)13-23(29)24(30)28-20-5-6-21-16(12-20)8-9-27-21/h1-13,27H,14H2,(H,28,30) |
| InChI Key | OCSHTBUKRNOLMC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC(=C1)F)CN2C3=C(C=C(C=C3)F)C=C2C(=O)NC4=CC5=C(C=C4)NC=C5 |
| CAS | |
| Splash | |
| Other Names | N-(1H-Indol-5-yl)-5-fluoro-1-(3-fluoro-benzyl)-1H-indole-2-carboxamide |
| ChemSpider | 29786997 |
| ChEMBL | CHEMBL3184858 |
| PubChem | 53316382 |