Systematic / IUPAC Name: 2,2-Dimethyl-1,3-benzodioxol-4-yl methylcarbamate
ID: Reference2795
Other Names:
Bencarbate;
Dycarb;
Ficam;
Fisons NC 6897;
Fuam
; more
Formula: C11H13NO4
Class: Pesticides/Herbicides
Bendiocarb mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1358 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 6/11/2015 12:30:33 PM |
| InChI | InChI=1S/C11H13NO4/c1-11(2)15-8-6-4-5-7(9(8)16-11)14-10(13)12-3/h4-6H,1-3H3,(H,12,13) |
| InChI Key | XEGGRYVFLWGFHI-UHFFFAOYSA-N |
| Canonical SMILES | CC1(OC2=C(O1)C(=CC=C2)OC(=O)NC)C |
| CAS | 22781233 |
| Splash | |
| Other Names |
Bencarbate; Dycarb; Ficam; Fisons NC 6897; Fuam; Garvox; Garvox 3G; Multamat; Multimet; Niomil; Rotate; Sedox; Seedox; Seedoxin; Tatoo; Tattoo; Turcam; (2,2-Dimethyl-1,3-benzodioxol-4-yl) N-methylcarbamate; 1,3-Benzodioxol-4-ol, 2,2-dimethyl, methylcarbamate; 1,3-Benzodioxole, 2,2-dimethyl-4-(N-methylaminocarboxylato)-; 1,3-Benzodioxole, 2,2-dimethyl-4-(N-methylcarbamato)-; 2,2-Dimethyl-1,3-benzdioxol-4-yl N-methylcarbamate; 2,2-Dimethyl-1,3-benzodioxol-4-ol methylcarbamate; 2,2-Dimethyl-1,3-benzodioxole-N-methylcarbamate; 2,2-Dimethyl-4-(methylcarbamoyloxy)-1,3-benzodioxole; 2,2-Dimethylbenzo-1,3-dioxol-4-yl methylcarbamate; 2,3-Isopropylidenedioxyphenyl methylcarbamate; Carbamic acid, methyl, 2,3-(dimethylmethylenedioxy)phenyl ester; Carbamic acid, methyl, 2,3-(isopropylidenedioxy)phenyl ester; Methylcarbamic acid 2,3-(isopropylidenedioxy)phenyl ester |
| ChemIDPlus | 022781233 |
| PubChem | 2314 |
| Wikipedia | Bendiocarb |
| KEGG | C14433 |
| ChemSpider | 2224 |
| ChEBI | CHEBI:34556 |