Systematic / IUPAC Name: 2-Diethylaminoethanol
ID: Reference2816
Other Names:
DEAE;
β-Diethylaminoethanol;
β-Diethylaminoethyl alcohol;
β-Hydroxytriethylamine;
(2-Hydroxyethyl)diethylamine
; more
Formula: C6H15NO
Class: Industrial Chemicals Excipients/Additives/Colorants Textile Chemicals/Auxiliary/Dyes Endogenous Metabolites Sports Doping Drugs
N,N-Diethylethanolamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 118 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/17/2015 10:15:29 AM |
| InChI | InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
| InChI Key | BFSVOASYOCHEOV-UHFFFAOYSA-N |
| Canonical SMILES | CCN(CC)CCO |
| CAS | 100378 |
| Splash | |
| Other Names |
DEAE; β-Diethylaminoethanol; β-Diethylaminoethyl alcohol; β-Hydroxytriethylamine; (2-Hydroxyethyl)diethylamine; N-(2-Hydroxyethyl)diethylamine; N-(Diethylamino)ethanol; N, N-Diethylethanolamine; N,N-Diethyl-N-(β-hydroxyethyl)amine; N,N-Diethyl-2-aminoethanol; N,N-Diethyl-2-hydroxyethylamine; N,N-Diethylaminoethanol; N,N-Diethylmonoethanolamine; N-Diethylaminoethanol; 2-(N,N-Diethylamino)ethanol; 2-(Diethylamino)-ethanol; 2-(Diethylamino)ethyl alcohol; 2-N-Diethylaminoethanol; 2-Diethylaminoethanol; 2-Hydroxytriethylamine; Diaethylaminoaethanol; Diethyl(2-hydroxyethyl)amine; Diethylethanolamine; Diethylmonoethanolamine; Ethanol,2-diethylamino |
| HMDb | HMDB33971 |
| Wikipedia | Diethylethanolamine |
| PubChem | 7497 |
| ChEBI | CHEBI:52153 |
| ChemSpider | 13842001 |