Systematic / IUPAC Name: 2-Butoxycarbonylbenzoic acid
ID: Reference2821
Other Names:
2-(Butoxycarbonyl)benzoic acid;
MBP;
1,2-Benzenedicarboxylic acid 1-butyl ester;
1,2-Benzenedicarboxylic acid, monobutyl ester;
Butyl hydrogen phthalate
; more
Formula: C12H14O4
Class: Extractables/Leachables Industrial Chemicals Endogenous Metabolites
Monobutyl phthalate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 219 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/18/2015 10:40:13 AM |
| InChI | InChI=1S/C12H14O4/c1-2-3-8-16-12(15)10-7-5-4-6-9(10)11(13)14/h4-7H,2-3,8H2,1H3,(H,13,14) |
| InChI Key | YZBOVSFWWNVKRJ-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)O |
| CAS | 131704 |
| Splash | |
| Other Names |
2-(Butoxycarbonyl)benzoic acid; MBP; 1,2-Benzenedicarboxylic acid 1-butyl ester; 1,2-Benzenedicarboxylic acid, monobutyl ester; Butyl hydrogen phthalate; Mono-n-butyl phthalate; Phthalic acid butyl ester; Phthalic acid mono-n-butyl ester; Phthalic acid monobutyl ester |