Systematic / IUPAC Name: 4-{Bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium
ID: Reference2833
Other Names:
Crystal violet base;
Crystal violet carbocation;
Crystal violet cation;
Gentian violet carbocation;
Gentian violet cation
; more
Formula: C25H30N3 +
Class: Therapeutics/Prescription Drugs Textile Chemicals/Auxiliary/Dyes Personal Care Products/Cosmetics Illegal Additives
Gentian violet mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 237 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/1/2016 11:21:37 AM |
| InChI | InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1 |
| InChI Key | LGLFFNDHMLKUMI-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C |
| CAS | 548629 |
| Splash | |
| Other Names |
Crystal violet base; Crystal violet carbocation; Crystal violet cation; Gentian violet carbocation; Gentian violet cation; Pyoctanin; Pyoctanine; 4-{Bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium; Bis[p-(dimethylamino)phenyl][p-(dimethylammonio)phenyl]methylium ; Methylium, tris[4-(dimethylamino)phenyl]-; Tris[4-(dimethylamino)phenyl]methylium |
| ChEBI | CHEBI:77181 |
| Wikipedia | Crystal violet |
| ChemSpider | 3349 |
| HMDb | HMDB14550 |
| PubChem | 3468 |
| ChemIDPlus | 014426256; 065294179; 072927787 |
| DrugBank | DB00406 |