Systematic / IUPAC Name: 3,4-Dimethylbenzenesulfonic acid
ID: Reference2848
Other Names: Benzenesulfonic acid, 3,4-dimethyl-
Formula: C8H10O3S
Class: Extractables/Leachables Personal Care Products/Cosmetics Textile Chemicals/Auxiliary/Dyes
Xylenesulfonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:50:15 AM |
| InChI | InChI=1S/C8H10O3S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) |
| InChI Key | WYCOJIVDCGJKDB-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=C(C=C1)S(=O)(=O)O)C |
| CAS | 1300727 |
| Splash | |
| Other Names | Benzenesulfonic acid, 3,4-dimethyl- |
| PubChem | 14756 |
| ChemIDPlus | 001300727 |
| ChemSpider | 14073 |
| ChEMBL | CHEMBL1624040 |