Systematic / IUPAC Name: 4,4'-Sulfonylbis(2-allylphenol)
ID: Reference2851
Other Names:
4-[(4-Hydroxy-3-prop-2-enylphenyl)sulfonyl]-2-prop-2-enylphenol;
Bis(3-allyl-4-hydroxyphenyl) sulfone
Formula: C18H18O4S
Class: Textile Chemicals/Auxiliary/Dyes
4,4'-Sulfonylbis[2-(prop-2-en-1-yl)phenol] mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 215 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/23/2015 6:23:47 AM |
| InChI | InChI=1S/C18H18O4S/c1-3-5-13-11-15(7-9-17(13)19)23(21,22)16-8-10-18(20)14(12-16)6-4-2/h3-4,7-12,19-20H,1-2,5-6H2 |
| InChI Key | MTMKZABGIQJAEX-UHFFFAOYSA-N |
| Canonical SMILES | C=CCC1=C(C=CC(=C1)S(=O)(=O)C2=CC(=C(C=C2)O)CC=C)O |
| CAS | 41481667 |
| Splash | |
| Other Names |
4-[(4-Hydroxy-3-prop-2-enylphenyl)sulfonyl]-2-prop-2-enylphenol; Bis(3-allyl-4-hydroxyphenyl) sulfone |
| ChemIDPlus | 041481667 |
| PubChem | 833466 |
| ChEMBL | CHEMBL1322154 |
| ChemSpider | 727854 |