Systematic / IUPAC Name: Oxydi-1,2-propanediyl dibenzoate
ID: Reference2873
Other Names:
Oxydipropane-1,2-diyl dibenzoate;
1-(2-Benzoyloxypropoxy)propan-2-yl benzoate
Formula: C20H22O5
Class: Extractables/Leachables Industrial Chemicals Textile Chemicals/Auxiliary/Dyes Personal Care Products/Cosmetics
Dipropyleneglycol dibenzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/29/2015 12:30:14 PM |
| InChI | InChI=1S/C20H22O5/c1-15(24-19(21)17-9-5-3-6-10-17)13-23-14-16(2)25-20(22)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3 |
| InChI Key | IZYUWBATGXUSIK-UHFFFAOYSA-N |
| Canonical SMILES | CC(COCC(C)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
| CAS | 27138314 |
| Splash | |
| Other Names |
Oxydipropane-1,2-diyl dibenzoate; 1-(2-Benzoyloxypropoxy)propan-2-yl benzoate |
| ChemSpider | 91768 |
| PubChem | 101560 |
| ChEMBL | CHEMBL1877406 |
| ChemIDPlus | 000094031 |