Systematic / IUPAC Name: (1'-Ethyl-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,3,4-oxadiazol-2-yl)-4-biphenylyl]methanone
ID: Reference2878
Other Names:
SB236057;
Methanone, (1'-ethyl-6,7-dihydrospiro[2H-furo[2,3-f]indole-3(5H),4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,3,4-oxadiazol-2-yl)[1,1'-biphenyl]-4-yl]-
Formula: C33H34N4O3
SB236057A mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 6/26/2015 1:14:19 PM |
| InChI | InChI=1S/C33H34N4O3/c1-4-36-15-12-33(13-16-36)20-39-30-18-25-11-14-37(29(25)19-28(30)33)32(38)24-7-5-23(6-8-24)27-10-9-26(17-21(27)2)31-35-34-22(3)40-31/h5-10,17-19H,4,11-16,20H2,1-3H3 |
| InChI Key | WXAKEEQOWUHGCI-UHFFFAOYSA-N |
| Canonical SMILES | CCN1CCC2(CC1)COC3=CC4=C(C=C23)N(CC4)C(=O)C5=CC=C(C=C5)C6=C(C=C(C=C6)C7=NN=C(O7)C)C |
| CAS | |
| Splash | |
| Other Names |
SB236057; Methanone, (1'-ethyl-6,7-dihydrospiro[2H-furo[2,3-f]indole-3(5H),4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,3,4-oxadiazol-2-yl)[1,1'-biphenyl]-4-yl]- |
| ChEMBL | CHEMBL1628625 |
| Wikipedia | SB-236057 |
| PubChem | 5311426 |
| ChemSpider | 4470914 |