Systematic / IUPAC Name: 3-{4-[2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-1H-indol-1-yl}propanoic acid
ID: Reference2891
Other Names: 1H-Indole-1-propanoic acid, 4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]-
Formula: C23H22N2O4
PD-0333941 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 219 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/7/2015 1:01:49 PM |
| InChI | InChI=1S/C23H22N2O4/c1-16-19(24-23(29-16)17-6-3-2-4-7-17)12-15-28-21-9-5-8-20-18(21)10-13-25(20)14-11-22(26)27/h2-10,13H,11-12,14-15H2,1H3,(H,26,27) |
| InChI Key | OMSPUVWUIHNYCS-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CCOC3=CC=CC4=C3C=CN4CCC(=O)O |
| CAS | 501027492 |
| Splash | |
| Other Names | 1H-Indole-1-propanoic acid, 4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]- |
| ChemSpider | 8310489 |
| PubChem | 10134976 |
| ChEMBL | CHEMBL3186355 |