Systematic / IUPAC Name: 2-(2-Ethylhexoxycarbonyl)benzoic acid
ID: Reference2914
Other Names:
(2-Ethylhexyl) hydrogen phthalate;
1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester;
2-{[(2-Ethylhexyl)oxy]carbonyl}benzoic acid ;
2-(2-Ethylhexyloxycarbonyl)benzoic acid;
2-{[(2-Ethylhexyl)oxy]carbonyl}benzoic acid
; more
Formula: C16H22O4
Class: Extractables/Leachables Endogenous Metabolites
Mono(2-ethylhexyl) phthalate (MEHP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 196 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/15/2015 8:12:27 AM |
| InChI | InChI=1S/C16H22O4/c1-3-5-8-12(4-2)11-20-16(19)14-10-7-6-9-13(14)15(17)18/h6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,17,18) |
| InChI Key | DJDSLBVSSOQSLW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)O |
| CAS | 4376209 |
| Splash | |
| Other Names |
(2-Ethylhexyl) hydrogen phthalate; 1,2-Benzenedicarboxylic acid, mono(2-ethylhexyl) ester; 2-{[(2-Ethylhexyl)oxy]carbonyl}benzoic acid ; 2-(2-Ethylhexyloxycarbonyl)benzoic acid; 2-{[(2-Ethylhexyl)oxy]carbonyl}benzoic acid; 2-Ethylhexyl hydrogen phthalate; Mono-2-ethylhexyl phthalate; Monoethylhexyl phthalate; Phthalate, mono(2-ethylhexyl); Phthalic acid mono-2-ethylhexyl ester; Phthalic acid, 2-ethylhexyl ester; Phthalic acid, mono-2-ethylhexyl ester |