Systematic / IUPAC Name: 2-[4-Chloro-6-(2,3-dimethylanilino)pyrimidin-2-yl]sulfanylacetic acid
ID: Reference2930
Other Names:
Pirnixic acid;
WY-14643 ;
Wyeth-14643;
({4-Chloro-6-[(2,3-dimethylphenyl)amino]-2-pyrimidinyl}thio)acetic acid ;
({4-Chloro-6-[(2,3-dimethylphenyl)amino]pyrimidin-2-yl}sulfanyl)acetic acid
; more
Formula: C14H14ClN3O2S
Class: Therapeutics/Prescription Drugs
Pirinixic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 437 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 7/24/2015 12:14:43 PM |
| InChI | InChI=1S/C14H14ClN3O2S/c1-8-4-3-5-10(9(8)2)16-12-6-11(15)17-14(18-12)21-7-13(19)20/h3-6H,7H2,1-2H3,(H,19,20)(H,16,17,18) |
| InChI Key | SZRPDCCEHVWOJX-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)NC2=CC(=NC(=N2)SCC(=O)O)Cl)C |
| CAS | 50892234 |
| Splash | |
| Other Names |
Pirnixic acid; WY-14643 ; Wyeth-14643; ({4-Chloro-6-[(2,3-dimethylphenyl)amino]-2-pyrimidinyl}thio)acetic acid ; ({4-Chloro-6-[(2,3-dimethylphenyl)amino]pyrimidin-2-yl}sulfanyl)acetic acid; ({4-Chloro-6-[(2,3-dimethylphenyl)amino]pyrimidin-2-yl}thio)acetic acid; [4-Chloro-6-(2,3-xylidino)-2-pyrimidinylthio]acetic acid; {[4-Chloro-6-(2,3-dimethylanilino)-2-pyrimidinyl]thio}acetic acid ; {[4-Chloro-6-(2,3-xylidino)-2-pyrimidinyl]thio}acetic acid ; 2-{4-Chloro-6-[(2,3-dimethylphenyl)amino]pyrimidin-2-yl}sulfanylacetic acid ; 4-Chloro-6-(2,3-dimethylphenyl)amino-2-pyrimidinylthioacetic acid; 4-Chloro-6-(2,3-xylidino)-2-pyrimidinylthioacetic acid; 4-Chloro-6-(2,3-xylidinyl)-2-pyrimidinylthioacetic acid; Acetic acid, ({4-chloro-6-[(2,3-dimethylphenyl)amino]-2-pyrimidinyl}thio)- ; Acetic acid, {[4-chloro-6-(2,3-xylidino)-2-pyrimidinyl]thio}- ; Acetic acid, 2-({4-chloro-6-[(2,3-dimethylphenyl)amino]-2-pyrimidinyl}thio)- |
| ChemSpider | 5492 |
| Wikipedia | Pirinixic acid |
| KEGG | C15617 |
| PubChem | 5694 |
| ChemIDPlus | 050892234 |
| ChEBI | CHEBI:32509 |