Systematic / IUPAC Name: (2-Ethyl-4-{[(4-{[4-(4-methoxyphenyl)-1-piperazinyl]methyl}-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl)methyl]sulfanyl}phenoxy)acetic acid
ID: Reference2932
Other Names: Acetic acid, 2-(2-ethyl-4-{[(4-{[4-(4-methoxyphenyl)-1-piperazinyl]methyl}-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl)methyl]thio}phenoxy)-
Formula: C33H34F3N3O4S2
PharmaGSID 47315 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 422 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:58:14 PM |
| InChI | InChI=1S/C33H34F3N3O4S2/c1-3-22-18-27(12-13-29(22)43-20-31(40)41)44-21-30-28(37-32(45-30)23-4-6-24(7-5-23)33(34,35)36)19-38-14-16-39(17-15-38)25-8-10-26(42-2)11-9-25/h4-13,18H,3,14-17,19-21H2,1-2H3,(H,40,41) |
| InChI Key | CESIUPFUCGHEPP-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=C(C=CC(=C1)SCC2=C(N=C(S2)C3=CC=C(C=C3)C(F)(F)F)CN4CCN(CC4)C5=CC=C(C=C5)OC)OCC(=O)O |
| CAS | 444610917 |
| Splash | |
| Other Names | Acetic acid, 2-(2-ethyl-4-{[(4-{[4-(4-methoxyphenyl)-1-piperazinyl]methyl}-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl)methyl]thio}phenoxy)- |
| PubChem | 10233356 |
| ChemSpider | 8408844 |
| ChEMBL | CHEMBL3184155 |