Systematic / IUPAC Name: 6-Methylquinoline
ID: Reference2933
Other Names:
p-Toluquinoline;
Tolliquinoline, p-;
Quinoline, 6-methyl-
Formula: C10H9N
Class: Excipients/Additives/Colorants Endogenous Metabolites
6-Methylquinoline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 7/27/2015 10:47:28 AM |
| InChI | InChI=1S/C10H9N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h2-7H,1H3 |
| InChI Key | LUYISICIYVKBTA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)N=CC=C2 |
| CAS | 91623 |
| Splash | |
| Other Names |
p-Toluquinoline; Tolliquinoline, p-; Quinoline, 6-methyl- |
| PubChem | 7059 |
| ChemSpider | 6792 |
| HMDb | HMDB33115 |
| ChEMBL | CHEMBL1412508 |
| ChemIDPlus | 000091623 |