Systematic / IUPAC Name: 4-{[(1-{(2S)-3-(2,3-Dihydro-1H-inden-5-yloxy)-2-[(2-methoxyethoxy)methyl]-3-oxopropyl}cyclopentyl)carbonyl]amino}cyclohexanecarboxylic acid
ID: Reference2952
Other Names:
Formula: C29H41NO7
Class: Therapeutics/Prescription Drugs
Candoxatril mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 388 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 7/29/2015 9:08:28 AM |
| InChI | InChI=1S/C29H41NO7/c1-35-15-16-36-19-23(27(33)37-25-12-9-20-5-4-6-22(20)17-25)18-29(13-2-3-14-29)28(34)30-24-10-7-21(8-11-24)26(31)32/h9,12,17,21,23-24H,2-8,10-11,13-16,18-19H2,1H3,(H,30,34)(H,31,32)/t21?,23-,24?/m0/s1 |
| InChI Key | ZTWZVMIYIIVABD-RZMWZJFBSA-N |
| Canonical SMILES | COCCOCC(CC1(CCCC1)C(=O)NC2CCC(CC2)C(=O)O)C(=O)OC3=CC4=C(CCC4)C=C3 |
| CAS | 123122554 |
| Splash | |
| Other Names |
| ChemIDPlus | 123122554 |
| KEGG | D01070 |
| Wikipedia | Candoxatril |
| PubChem | 5362417 |
| ChemSpider | 4515031 |