Systematic / IUPAC Name: 2-Amino-3-hydroxypropanoic acid
ID: Reference2964
Other Names:
Serine, DL-;
α-Amino-β-hydroxypropionic acid;
β-Hydroxyalanine;
2-Amino-3-hydroxy-propionic acid;
3-Hydroxyalanine
; more
Formula: C3H7NO3
Class: Endogenous Metabolites Therapeutics/Prescription Drugs Excipients/Additives/Colorants Personal Care Products/Cosmetics Natural Products/Medicines
DL-Serine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 94 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/30/2015 11:13:13 AM |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7) |
| InChI Key | MTCFGRXMJLQNBG-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(=O)O)N)O |
| CAS | 302841 |
| Splash | |
| Other Names |
Serine, DL-; α-Amino-β-hydroxypropionic acid; β-Hydroxyalanine; 2-Amino-3-hydroxy-propionic acid; 3-Hydroxyalanine; DL-2-Amino-3-hydroxypropionic acid; Propanoic acid, 2-amino-3-hydroxy-; Ser |
| ChemIDPlus | 000302841; 033849104 |
| ChEBI | CHEBI:35243; CHEBI:17822 |
| PubChem | 617 |
| Wikipedia | Serine |
| KEGG | C00716 |
| ChemSpider | 597 |