Systematic / IUPAC Name: 3-{2-[(Dimethylamino)methyl]-1-hydroxycyclohexyl}phenol
ID: Reference2975
Other Names: Phenol, m-[2-(dimethylaminomethyl)-1-hydroxycyclohexyl]-
Formula: C15H23NO2
Class: Drugs of Abuse/Illegal Drugs Endogenous Metabolites Sports Doping Drugs Therapeutics/Prescription Drugs
O-Desmethyltramadol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 137 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 3/17/2016 12:05:17 PM |
| InChI | InChI=1S/C15H23NO2/c1-16(2)11-13-6-3-4-9-15(13,18)12-7-5-8-14(17)10-12/h5,7-8,10,13,17-18H,3-4,6,9,11H2,1-2H3 |
| InChI Key | UWJUQVWARXYRCG-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)CC1CCCCC1(C2=CC(=CC=C2)O)O |
| CAS | 80456811 |
| Splash | |
| Other Names | Phenol, m-[2-(dimethylaminomethyl)-1-hydroxycyclohexyl]- |
| ChemIDPlus | 073986535 |
| ChemSpider | 115703 |
| Wikipedia | O-Desmethyltramadol |
| PubChem | 130829 |