Systematic / IUPAC Name: Bis(2,4-dihydroxyphenyl)methanone
ID: Reference2979
Other Names:
Benzophenone-2;
Uvinol D-50;
Uvinul D-50;
Di-2,4-Dihydroxyphenyl ketone ;
Methanone, bis(2,4-dihydroxyphenyl)-
Formula: C13H10O5
Class: Personal Care Products/Cosmetics
2,2',4,4'-Tetrahydroxybenzophenone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 258 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 8/24/2015 7:22:03 AM |
| InChI | InChI=1S/C13H10O5/c14-7-1-3-9(11(16)5-7)13(18)10-4-2-8(15)6-12(10)17/h1-6,14-17H |
| InChI Key | WXNRYSGJLQFHBR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1O)O)C(=O)C2=C(C=C(C=C2)O)O |
| CAS | 131555 |
| Splash | |
| Other Names |
Benzophenone-2; Uvinol D-50; Uvinul D-50; Di-2,4-Dihydroxyphenyl ketone ; Methanone, bis(2,4-dihydroxyphenyl)- |
| ChemIDPlus | 000131555 |
| PubChem | 8571 |
| ChEMBL | CHEMBL3185091 |
| ChemSpider | 8253 |