Systematic / IUPAC Name: 5,5-Dimethylimidazolidine-2,4-dione
ID: Reference2985
Other Names:
Dantoin 736;
DM Hydantoin;
2,4-Imidazolidinedione, 5,5-dimethyl-;
5,5-Dimethyl hydantoin;
5,5-Dimethyl-1,3-diazolidine-2,4-dione
; more
Formula: C5H8N2O2
Class: Endogenous Metabolites Extractables/Leachables Pesticides/Herbicides Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
5,5-Dimethylhydantoin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 69 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 3/29/2018 8:20:56 AM |
| InChI | InChI=1S/C5H8N2O2/c1-5(2)3(8)6-4(9)7-5/h1-2H3,(H2,6,7,8,9) |
| InChI Key | YIROYDNZEPTFOL-UHFFFAOYSA-N |
| Canonical SMILES | CC1(C(=O)NC(=O)N1)C |
| CAS | 77714 |
| Splash | |
| Other Names |
Dantoin 736; DM Hydantoin; 2,4-Imidazolidinedione, 5,5-dimethyl-; 5,5-Dimethyl hydantoin; 5,5-Dimethyl-1,3-diazolidine-2,4-dione; 5,5-Dimethyl-2,4-imidazolidinedione; 5,5-Dimethyl-imidazolidin-2,4-dion; 5,5-Dimethylimidazolidin-2,4-dione; 5,5-Dimethyl-imidazolidine-2,4-dione; Dimethylhydantoin; Hydantoin, 5,5-dimethyl-; Dantoin DMH |
| ChemSpider | 6246 |
| ChEMBL | CHEMBL3181806 |
| PubChem | 6491 |
| ChemIDPlus | 000077714 |