Systematic / IUPAC Name: (1S)-1-{4-[(2R,6S)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2,6-dimethylpiperazin-1-yl]pyrimidin-2-yl}ethanol
ID: Reference3002
Other Names: (1S)-1-{4-[(2R,6S)-4-(4,6-Dimethyl-1,3,5-triazin-2-yl)-2,6-dimethyl-1-piperazinyl]-2-pyrimidinyl}ethanol
Formula: C17H25N7O
CP-642931 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 9/9/2015 8:20:50 AM |
| InChI | InChI=1S/C17H25N7O/c1-10-8-23(17-20-13(4)19-14(5)21-17)9-11(2)24(10)15-6-7-18-16(22-15)12(3)25/h6-7,10-12,25H,8-9H2,1-5H3/t10-,11+,12-/m0/s1 |
| InChI Key | FTEQMUXMWCGJAF-TUAOUCFPSA-N |
| Canonical SMILES | CC1CN(CC(N1C2=NC(=NC=C2)C(C)O)C)C3=NC(=NC(=N3)C)C |
| CAS | |
| Splash | |
| Other Names | (1S)-1-{4-[(2R,6S)-4-(4,6-Dimethyl-1,3,5-triazin-2-yl)-2,6-dimethyl-1-piperazinyl]-2-pyrimidinyl}ethanol |