Systematic / IUPAC Name: 7-Chloro-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one 4-oxide
ID: Reference3003
Other Names:
Chlordiazepoxide lactam;
Nordazepam oxide;
1,3-Dihydro-7-chloro-5-phenyl-2H-1,4-benzodiazepin-2-one 4-oxide;
2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-7-chloro-5-phenyl-, 4-oxide
Formula: C15H11ClN2O2
Class: Therapeutics/Prescription Drugs Endogenous Metabolites Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Demoxepam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 166 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 3/17/2016 12:28:49 PM |
| InChI | InChI=1S/C15H11ClN2O2/c16-11-6-7-13-12(8-11)15(10-4-2-1-3-5-10)18(20)9-14(19)17-13/h1-8H,9H2,(H,17,19) |
| InChI Key | GGRWZBVSUZZMKS-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 963393 |
| Splash | |
| Other Names |
Chlordiazepoxide lactam; Nordazepam oxide; 1,3-Dihydro-7-chloro-5-phenyl-2H-1,4-benzodiazepin-2-one 4-oxide; 2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-7-chloro-5-phenyl-, 4-oxide |
| KEGG | D02600 |
| ChemSpider | 10441314 |
| Wikipedia | Demoxepam |
| HMDb | HMDB41867 |
| ChEMBL | CHEMBL1597677 |