Systematic / IUPAC Name: 1-Benzyl-1-{[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl}-3-(2,4,6-trifluorophenyl)urea
ID: Reference3013
Other Names: Urea, N-{[3-(4-chlorophenyl)-5-methyl-2-benzofuranyl]methyl}-N-(phenylmethyl)-N'-(2,4,6-trifluorophenyl)-
Formula: C30H22ClF3N2O2
FR 145237 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 182 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 9/11/2015 7:13:26 AM |
| InChI | InChI=1S/C30H22ClF3N2O2/c1-18-7-12-26-23(13-18)28(20-8-10-21(31)11-9-20)27(38-26)17-36(16-19-5-3-2-4-6-19)30(37)35-29-24(33)14-22(32)15-25(29)34/h2-15H,16-17H2,1H3,(H,35,37) |
| InChI Key | GJRPAGNTTAPJCC-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC2=C(C=C1)OC(=C2C3=CC=C(C=C3)Cl)CN(CC4=CC=CC=C4)C(=O)NC5=C(C=C(C=C5F)F)F |
| CAS | 146011656 |
| Splash | |
| Other Names | Urea, N-{[3-(4-chlorophenyl)-5-methyl-2-benzofuranyl]methyl}-N-(phenylmethyl)-N'-(2,4,6-trifluorophenyl)- |
| PubChem | 9850056 |
| ChEMBL | CHEMBL3187915 |
| ChemSpider | 8025769 |