Systematic / IUPAC Name: N-Ethyl-N-isopropyl-3-methyl-5-[(2S)-2-(4-pyridinylamino)propoxy]benzamide
ID: Reference3014
Other Names: N-Ethyl-N-isopropyl-3-methyl-5-{[(2S)-2-(pyridin-4-ylamino)propyl]oxy}benzamide
Formula: C21H29N3O2
GW 473178E mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 64 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 9/21/2015 8:30:28 AM |
| InChI | InChI=1S/C21H29N3O2/c1-6-24(15(2)3)21(25)18-11-16(4)12-20(13-18)26-14-17(5)23-19-7-9-22-10-8-19/h7-13,15,17H,6,14H2,1-5H3,(H,22,23)/t17-/m0/s1 |
| InChI Key | JMPSZYHYDMQFEO-KRWDZBQOSA-N |
| Canonical SMILES | CCN(C(C)C)C(=O)C1=CC(=CC(=C1)OCC(C)NC2=CC=NC=C2)C |
| CAS | 263553339 |
| Splash | |
| Other Names | N-Ethyl-N-isopropyl-3-methyl-5-{[(2S)-2-(pyridin-4-ylamino)propyl]oxy}benzamide |
| PubChem | 9820034 |
| DrugBank | DB07279 |
| ChEMBL | CHEMBL1230612 |
| ChemSpider | 7995783 |