Systematic / IUPAC Name: 1-Methyl-1H-benzotriazole
ID: Reference3031
Other Names:
1H-1,2,3-Benzotriazole, 1-methyl-;
1H-Benzotriazole, 1-methyl-;
1H-Benzotriazole, methyl-;
1-Methyl-1,2,3-benzotriazole;
1-Methyl-1H-1,2,3-benzotriazole
; more
Formula: C7H7N3
1-Methylbenzotriazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 67 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/25/2015 9:54:11 AM |
| InChI | InChI=1S/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 |
| InChI Key | HXQHRUJXQJEGER-UHFFFAOYSA-N |
| Canonical SMILES | CN1C2=CC=CC=C2N=N1 |
| CAS | 13351730 |
| Splash | |
| Other Names |
1H-1,2,3-Benzotriazole, 1-methyl-; 1H-Benzotriazole, 1-methyl-; 1H-Benzotriazole, methyl-; 1-Methyl-1,2,3-benzotriazole; 1-Methyl-1H-1,2,3-benzotriazole; 1-Methyl-1H-benzo[d][1,2,3]triazole; Methyl-1H-benzotriazole |
| ChEMBL | CHEMBL3086212 |
| ChemIDPlus | 013351730; 029385431 |
| ChemSpider | 24133 |
| PubChem | 25902 |