Systematic / IUPAC Name: Tris(1,3-dichloro-2-propanyl) phosphate
ID: Reference3034
            Other Names: 
                    Phosphoric acid tris(1,3-dichloropropan-2-yl) ester; 
                    Tris(1,3-dichloropropan-2-yl) phosphate; 
                    Tris[1,3-bis(chloranyl)propan-2-yl] phosphate; 
                    Phosphoric acid, tris(1,3-dichloro-2-propyl) ester; 
                    Tris(1,3-dichloro-2-propyl) phosphate
; more
        
Formula: C9H15Cl6O4P
Class: Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Tris(1,3-dichloro-2-propyl) phosphate (TDCPP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap | 
| No. of Spectral Trees | 1 | 
| No. of Spectra | 91 | 
| Tandem Spectra | MS1, MS2 | 
| Ionization Methods | APCI | 
| Analyzers | FT | 
| Last Modification | 3/17/2016 1:01:05 PM | 
| InChI | InChI=1S/C9H15Cl6O4P/c10-1-7(2-11)17-20(16,18-8(3-12)4-13)19-9(5-14)6-15/h7-9H,1-6H2 | 
| InChI Key | ASLWPAWFJZFCKF-UHFFFAOYSA-N | 
| Canonical SMILES | C(C(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl)Cl | 
| CAS | 13674878 | 
| Splash | |
| Other Names | Phosphoric acid tris(1,3-dichloropropan-2-yl) ester; Tris(1,3-dichloropropan-2-yl) phosphate; Tris[1,3-bis(chloranyl)propan-2-yl] phosphate; Phosphoric acid, tris(1,3-dichloro-2-propyl) ester; Tris(1,3-dichloro-2-propyl) phosphate; Tris(2-chloro-1-(chloromethyl)ethyl) phosphate; CRP (fireproofing agent) | 
| ChEMBL | CHEMBL3182032 | 
| PubChem | 26177 | 
| Wikipedia | Tris(1,3-dichloro-2-propyl)phosphate | 
| ChemSpider | 24388 | 
| ChemIDPlus | 013674878 |