Systematic / IUPAC Name: 5-(2-Chlorophenyl)-3-methyl-7-nitro-1,2-dihydropyrazolo[3,4-b][1,4]benzodiazepine
ID: Reference3041
Other Names:
Formula: C17H12ClN5O2
PharmaGSID 48505 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 318 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 9/29/2015 1:00:18 PM |
| InChI | InChI=1S/C17H12ClN5O2/c1-9-15-17(22-21-9)19-14-7-6-10(23(24)25)8-12(14)16(20-15)11-4-2-3-5-13(11)18/h2-8H,1H3,(H2,19,21,22) |
| InChI Key | UVLBAPBHAHFJSY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C2C(=NC3=C(C=C(C=C3)[N+](=O)[O-])C(=N2)C4=CC=CC=C4Cl)NN1 |
| CAS | |
| Splash | |
| Other Names |
| ChemSpider | 8060589 |
| PubChem | 9884915 |
| ChEMBL | CHEMBL1258821 |