Systematic / IUPAC Name: {2-[(2,6-Dichloro-4-hydroxyphenyl)amino]phenyl}acetic acid
ID: Reference3054
Other Names:
[o-(2,6-Dichloro-4-hydroxyanilino)phenyl]acetic acid ;
2-[(2,6-Dichloro-4-hydroxyphenyl)amino]benzeneacetic acid;
2-[2-(2,6-Dichloro-4-hydroxyanilino)phenyl]acetic acid;
2-{2-[(2,6-Dichloro-4-hydroxyphenyl)amino]phenyl}acetic acid;
Acetic acid, [o-(2,6-dichloro-4-hydroxyanilino)phenyl]-
Formula: C14H11Cl2NO3
Class: Endogenous Metabolites Therapeutics/Prescription Drugs Sports Doping Drugs
4'-Hydroxydiclofenac mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 122 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 7:45:58 AM |
| InChI | InChI=1S/C14H11Cl2NO3/c15-10-6-9(18)7-11(16)14(10)17-12-4-2-1-3-8(12)5-13(19)20/h1-4,6-7,17-18H,5H2,(H,19,20) |
| InChI Key | KGVXVPRLBMWZLG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=C(C=C2Cl)O)Cl |
| CAS | 64118849 |
| Splash | |
| Other Names |
[o-(2,6-Dichloro-4-hydroxyanilino)phenyl]acetic acid ; 2-[(2,6-Dichloro-4-hydroxyphenyl)amino]benzeneacetic acid; 2-[2-(2,6-Dichloro-4-hydroxyanilino)phenyl]acetic acid; 2-{2-[(2,6-Dichloro-4-hydroxyphenyl)amino]phenyl}acetic acid; Acetic acid, [o-(2,6-dichloro-4-hydroxyanilino)phenyl]- ; Benzeneacetic acid, 2-[(2,6-dichloro-4-hydroxyphenyl)amino]- |
| PubChem | 116545 |
| ChemSpider | 104192 |
| ChEBI | CHEBI:59613 |
| ChemIDPlus | 064118849 |
| HMDb | HMDB13974 |