Systematic / IUPAC Name: N-[4-(Benzylamino)-3-cyano-2-quinolinyl]-4-methoxybenzamide
ID: Reference3060
Other Names:
N-[4-(Benzylamino)-3-cyanoquinolin-2-yl]-4-methoxybenzamide;
Benzamide, N-{3-cyano-4-[(phenylmethyl)amino]-2-quinolinyl}-4-methoxy-
Formula: C25H20N4O2
SSR161421 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/29/2015 12:37:27 PM |
| InChI | InChI=1S/C25H20N4O2/c1-31-19-13-11-18(12-14-19)25(30)29-24-21(15-26)23(20-9-5-6-10-22(20)28-24)27-16-17-7-3-2-4-8-17/h2-14H,16H2,1H3,(H2,27,28,29,30) |
| InChI Key | FFHQNQNMELQOEF-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)NC2=NC3=CC=CC=C3C(=C2C#N)NCC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
N-[4-(Benzylamino)-3-cyanoquinolin-2-yl]-4-methoxybenzamide; Benzamide, N-{3-cyano-4-[(phenylmethyl)amino]-2-quinolinyl}-4-methoxy- |
| ChemSpider | 8376996 |
| PubChem | 10201497 |
| ChEMBL | CHEMBL3183125 |