Systematic / IUPAC Name: Methyl-(2S)-2-aminopropanoate
ID: Reference3087
Other Names:
(S)-Methyl 2-aminopropanoate;
L-Alanine, methyl ester;
Methyl L-alaninate
Formula: C4H9NO2
L-Alanine methyl ester mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 79 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 10/8/2015 10:49:04 AM |
| InChI | InChI=1S/C4H9NO2/c1-3(5)4(6)7-2/h3H,5H2,1-2H3/t3-/m0/s1 |
| InChI Key | DWKPPFQULDPWHX-VKHMYHEASA-N |
| Canonical SMILES | CC(C(=O)OC)N |
| CAS | |
| Splash | |
| Other Names |
(S)-Methyl 2-aminopropanoate; L-Alanine, methyl ester; Methyl L-alaninate |
| ChemSpider | 74306 |
| PubChem | 82335 |
| ChemIDPlus | 010065722 |
| ChEMBL | CHEMBL590283 |