Systematic / IUPAC Name: 1-[1-(2-Benzylphenoxy)-2-propanyl]piperidine
ID: Reference3090
Other Names:
Pirexyl;
1-{1-Methyl-2-[(α-phenyl-o-tolyl)oxy]ethyl}piperidine ;
1-[2-(2-Benzylphenoxy)-1-methylethyl]piperidine ;
1-[1-(2-Benzylphenoxy)propan-2-yl]piperidine;
Piperidine, 1-{1-methyl-2-[(α-phenyl-o-tolyl)oxy]ethyl}-
Formula: C21H27NO
Class: Therapeutics/Prescription Drugs
Benproperine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 49 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/9/2015 7:32:58 AM |
| InChI | InChI=1S/C21H27NO/c1-18(22-14-8-3-9-15-22)17-23-21-13-7-6-12-20(21)16-19-10-4-2-5-11-19/h2,4-7,10-13,18H,3,8-9,14-17H2,1H3 |
| InChI Key | JTUQXGZRVLWBCR-UHFFFAOYSA-N |
| Canonical SMILES | CC(COC1=CC=CC=C1CC2=CC=CC=C2)N3CCCCC3 |
| CAS | 2156276 |
| Splash | |
| Other Names |
Pirexyl; 1-{1-Methyl-2-[(α-phenyl-o-tolyl)oxy]ethyl}piperidine ; 1-[2-(2-Benzylphenoxy)-1-methylethyl]piperidine ; 1-[1-(2-Benzylphenoxy)propan-2-yl]piperidine; Piperidine, 1-{1-methyl-2-[(α-phenyl-o-tolyl)oxy]ethyl}- |
| ChemIDPlus | 002156276; 064238922 |
| PubChem | 2326 |
| Wikipedia | Benproperine |
| ChemSpider | 2236 |
| KEGG | D07512 |
| ChEMBL | CHEMBL2105910 |