Systematic / IUPAC Name: 3-Methoxybenzoic acid
ID: Reference3092
Other Names:
m-Anisic acid;
3-Carboxyanisole;
m-Methoxybenzoic acid;
m-Methylsalicylic acid;
3-Methoxy-benzoic acid
Formula: C8H8O3
Class: Excipients/Additives/Colorants Endogenous Metabolites
3-Anisic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 74 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | APCI |
| Analyzers | FT |
| Last Modification | 10/9/2015 7:41:03 AM |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChI Key | XHQZJYCNDZAGLW-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)C(=O)O |
| CAS | 586389 |
| Splash | |
| Other Names |
m-Anisic acid; 3-Carboxyanisole; m-Methoxybenzoic acid; m-Methylsalicylic acid; 3-Methoxy-benzoic acid; Benzoic acid, 3-methoxy- |
| Wikipedia | Anisic acid |
| HMDb | HMDB32606 |
| ChEMBL | CHEMBL22425 |
| PubChem | 11461 |
| ChemSpider | 10977 |
| ChemIDPlus | 000586389 |