Systematic / IUPAC Name: 2-Phenylphenol
ID: Reference3105
Other Names:
o-Xenol;
2-Fenylfenol;
Orthoxenol;
Tumescal 0PE;
(1,1'-Biphenyl)-2-ol
; more
Formula: C12H10O
Class: Endogenous Metabolites Pesticides/Herbicides Excipients/Additives/Colorants Industrial Chemicals Personal Care Products/Cosmetics Textile Chemicals/Auxiliary/Dyes
2-Phenylphenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 302 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 10/13/2015 2:19:51 PM |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |
| InChI Key | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=CC=CC=C2O |
| CAS | 90437 |
| Splash | |
| Other Names |
o-Xenol; 2-Fenylfenol; Orthoxenol; Tumescal 0PE; (1,1'-Biphenyl)-2-ol; (1,1-Biphenyl)-2-ol; o-Biphenylol; o-Diphenylol; o-Hydroxybiphenyl; o-Hydroxydiphenyl; o-Phenylphenate; o-Phenylphenol; 1,1'-Biphenyl-2-ol; 1-Hydroxy-2-phenylbenzene; 2-Biphenylol; 2-Hydroxy-1,1'-biphenyl; 2-Hydroxybifenyl; 2-Hydroxybiphenyl; 2-Hydroxydiphenyl; 2-Phenyl phenol; Biphenyl, 2-hydroxy-; Biphenyl-2-o-1; Biphenyl-2-ol; Biphenylol; Hydroxdiphenyl; Hydroxy-2-phenylbenzene; Hydroxybiphenyl; Orthohydroxydiphenyl; Orthophenyl phenol; Phenol, o-phenyl-; Phenyl-2 phenol; Phenylphenol; Phenylphenol (o-) |
| KEGG | C02499; D08367 |
| ChemSpider | 13839012 |
| Wikipedia | 2-Phenylphenol |
| ChEBI | CHEBI:17043 |
| HMDb | HMDB32582 |
| PubChem | 7017 |