Systematic / IUPAC Name: 2-Hydroxy-3-phenylpropanoic acid
ID: Reference311
Other Names:
β-Phenyllactic acid;
Lactic acid, 3-phenyl-;
2-Hydroxy-3-phenylpropionic acid;
Benzenepropanoic acid, α-hydroxy-;
3-Phenyl-2-hydroxypropanoic acid
Formula: C9H10O3
Class: Endogenous Metabolites
3-Phenyllactic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 319 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/11/2016 8:10:08 AM |
| InChI | InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChI Key | VOXXWSYKYCBWHO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CC(C(=O)O)O |
| CAS | 828013 |
| Splash | |
| Other Names |
β-Phenyllactic acid; Lactic acid, 3-phenyl-; 2-Hydroxy-3-phenylpropionic acid; Benzenepropanoic acid, α-hydroxy-; 3-Phenyl-2-hydroxypropanoic acid; α-Hydroxybenzenepropanoic acid |