Systematic / IUPAC Name: {4-[5-(Aminomethyl)-2-fluorophenyl]-1-piperidinyl}(4-bromo-3-methyl-5-propoxy-2-thienyl)methanone
ID: Reference3132
Other Names: Methanone, {4-[5-(aminomethyl)-2-fluorophenyl]-1-piperidinyl}(4-bromo-3-methyl-5-propoxy-2-thienyl)-
Formula: C21H26BrFN2O2S
AVE8923 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/20/2015 7:19:08 AM |
| InChI | InChI=1S/C21H26BrFN2O2S/c1-3-10-27-21-18(22)13(2)19(28-21)20(26)25-8-6-15(7-9-25)16-11-14(12-24)4-5-17(16)23/h4-5,11,15H,3,6-10,12,24H2,1-2H3 |
| InChI Key | IFWLUOOAWLUBQN-UHFFFAOYSA-N |
| Canonical SMILES | CCCOC1=C(C(=C(S1)C(=O)N2CCC(CC2)C3=C(C=CC(=C3)CN)F)C)Br |
| CAS | |
| Splash | |
| Other Names | Methanone, {4-[5-(aminomethyl)-2-fluorophenyl]-1-piperidinyl}(4-bromo-3-methyl-5-propoxy-2-thienyl)- |
| PubChem | 11477652 |
| ChEMBL | CHEMBL3302241 |
| ChemSpider | 9652480 |