Systematic / IUPAC Name: (2E)-N-[1-(Dimethylamino)-1-oxo-2-butanyl]-N-ethyl-2-butenamide
ID: Reference3145
Other Names:
Crotethamid;
N-(N'-Crotonyl-N'-ethyl)amino-N,N-dimethylbutyramide ;
N-[1-(Dimethylcarbamoyl)propyl]-N-ethylcrotonamide;
N-{1-[(Dimethylamino)carbonyl]propyl}-N-ethyl-2-butenamide ;
2-Butenamide, N-{1-[(dimethylamino)carbonyl]propyl}-N-ethyl-
Formula: C12H22N2O2
Class: Therapeutics/Prescription Drugs Sports Doping Drugs Drugs of Abuse/Illegal Drugs
Crotetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 49 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/21/2015 11:16:36 AM |
| InChI | InChI=1S/C12H22N2O2/c1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9-10H,7-8H2,1-5H3/b9-6+ |
| InChI Key | LSAMUAYPDHUBQD-RMKNXTFCSA-N |
| Canonical SMILES | CCC(C(=O)N(C)C)N(CC)C(=O)C=CC |
| CAS | 6168769 |
| Splash | |
| Other Names |
Crotethamid; N-(N'-Crotonyl-N'-ethyl)amino-N,N-dimethylbutyramide ; N-[1-(Dimethylcarbamoyl)propyl]-N-ethylcrotonamide; N-{1-[(Dimethylamino)carbonyl]propyl}-N-ethyl-2-butenamide ; 2-Butenamide, N-{1-[(dimethylamino)carbonyl]propyl}-N-ethyl- ; Crotethamide |
| ChEMBL | CHEMBL2104177 |
| KEGG | D07755 |
| ChemIDPlus | 006168769 |
| PubChem | 5368010 |
| ChemSpider | 4519436 |